C17H16N6O3 — CID 90956136
(5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-3-[4-(1-isocyanocyclopropyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 90956136) has the molecular formula C17H16N6O3 and a molecular weight of 352.35 g/mol. Its IUPAC name is (5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-3-[4-(1-isocyanocyclopropyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-3-[4-(1-isocyanocyclopropyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 90956136 |
| Molecular Formula | C17H16N6O3 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | (5R)-5-[[4-(hydroxyiminomethyl)triazol-1-yl]methyl]-3-[4-(1-isocyanocyclopropyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C1(c2ccc(N3C[C@H](Cn4cc(C=NO)nn4)OC3=O)cc2)CC1 |
| InChI | InChI=1S/C17H16N6O3/c1-18-17(6-7-17)12-2-4-14(5-3-12)23-11-15(26-16(23)24)10-22-9-13(8-19-25)20-21-22/h2-5,8-9,15,25H,6-7,10-11H2/t15-/m0/s1 |
| InChIKey | INSABWGZRRLLIQ-HNNXBMFYSA-N |
| XLogP | 2.02 |
| TPSA | 97.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|