C17H17N5O2 — CID 20616660
3-[4-(1-isocyanocyclopropyl)-3-methylphenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 20616660) has the molecular formula C17H17N5O2 and a molecular weight of 323.36 g/mol. Its IUPAC name is 3-[4-(1-isocyanocyclopropyl)-3-methylphenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-[4-(1-isocyanocyclopropyl)-3-methylphenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 20616660 |
| Molecular Formula | C17H17N5O2 |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 3-[4-(1-isocyanocyclopropyl)-3-methylphenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | [C-]#[N+]C1(c2ccc(N3CC(Cn4ccnn4)OC3=O)cc2C)CC1 |
| InChI | InChI=1S/C17H17N5O2/c1-12-9-13(3-4-15(12)17(18-2)5-6-17)22-11-14(24-16(22)23)10-21-8-7-19-20-21/h3-4,7-9,14H,5-6,10-11H2,1H3 |
| InChIKey | JYMZHTCWXCPJSG-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|