C18H22BFN4O4 — CID 23626595
(5R)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 23626595) has the molecular formula C18H22BFN4O4 and a molecular weight of 388.21 g/mol. Its IUPAC name is (5R)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 23626595 |
| Molecular Formula | C18H22BFN4O4 |
| Molecular Weight | 388.21 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (5R)-3-[3-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | CC1(C)OB(c2ccc(N3C[C@H](Cn4ccnn4)OC3=O)cc2F)OC1(C)C |
| InChI | InChI=1S/C18H22BFN4O4/c1-17(2)18(3,4)28-19(27-17)14-6-5-12(9-15(14)20)24-11-13(26-16(24)25)10-23-8-7-21-22-23/h5-9,13H,10-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | XQCYMIJJORUVKO-ZDUSSCGKSA-N |
| XLogP | 1.74 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|