C14H15FN5O2S+ — CID 59988988
[[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-methylsulfanylmethylidene]azanium (PubChem CID 59988988) has the molecular formula C14H15FN5O2S+ and a molecular weight of 336.37 g/mol. Its IUPAC name is [[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-methylsulfanylmethylidene]azanium.
| Compound Name | [[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-methylsulfanylmethylidene]azanium |
|---|---|
| PubChem CID | 59988988 |
| Molecular Formula | C14H15FN5O2S+ |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | [[2-fluoro-4-[(5R)-2-oxo-5-(triazol-1-ylmethyl)-1,3-oxazolidin-3-yl]phenyl]-methylsulfanylmethylidene]azanium |
| SMILES | CSC(=[NH2+])c1ccc(N2C[C@H](Cn3ccnn3)OC2=O)cc1F |
| InChI | InChI=1S/C14H14FN5O2S/c1-23-13(16)11-3-2-9(6-12(11)15)20-8-10(22-14(20)21)7-19-5-4-17-18-19/h2-6,10,16H,7-8H2,1H3/p+1/t10-/m0/s1 |
| InChIKey | AGKQZPDTVAGZBW-JTQLQIEISA-O |
| XLogP | 0.31 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|