C16H17F2N5O3 — CID 126495772
(5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 126495772) has the molecular formula C16H17F2N5O3 and a molecular weight of 365.34 g/mol. Its IUPAC name is (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 126495772 |
| Molecular Formula | C16H17F2N5O3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (5R)-3-(3,5-difluoro-4-morpholin-4-ylphenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1cc(F)c(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C16H17F2N5O3/c17-13-7-11(8-14(18)15(13)21-3-5-25-6-4-21)23-10-12(26-16(23)24)9-22-2-1-19-20-22/h1-2,7-8,12H,3-6,9-10H2/t12-/m0/s1 |
| InChIKey | RRQNIRCIVQDRAN-LBPRGKRZSA-N |
| XLogP | 1.42 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|