C20H23F2N5O4S — CID 146310202
(5R)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one (PubChem CID 146310202) has the molecular formula C20H23F2N5O4S and a molecular weight of 467.50 g/mol. Its IUPAC name is (5R)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one.
| Compound Name | (5R)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146310202 |
| Molecular Formula | C20H23F2N5O4S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | (5R)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-5-(triazol-1-ylmethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1O[C@@H](Cn2ccnn2)CN1c1cc(F)c(N2CCC(C3CS(=O)(=O)C3)CC2)c(F)c1 |
| InChI | InChI=1S/C20H23F2N5O4S/c21-17-7-15(27-10-16(31-20(27)28)9-26-6-3-23-24-26)8-18(22)19(17)25-4-1-13(2-5-25)14-11-32(29,30)12-14/h3,6-8,13-14,16H,1-2,4-5,9-12H2/t16-/m0/s1 |
| InChIKey | KEZVUIBUSFGNFH-INIZCTEOSA-N |
| XLogP | 1.84 |
| TPSA | 97.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|