C18H21F2N5O4S — CID 146310344
(5R)-5-(azidomethyl)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-2-one (PubChem CID 146310344) has the molecular formula C18H21F2N5O4S and a molecular weight of 441.46 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 146310344 |
| Molecular Formula | C18H21F2N5O4S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[4-[4-(1,1-dioxothietan-3-yl)piperidin-1-yl]-3,5-difluorophenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2cc(F)c(N3CCC(C4CS(=O)(=O)C4)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C18H21F2N5O4S/c19-15-5-13(25-8-14(7-22-23-21)29-18(25)26)6-16(20)17(15)24-3-1-11(2-4-24)12-9-30(27,28)10-12/h5-6,11-12,14H,1-4,7-10H2/t14-/m0/s1 |
| InChIKey | VDPYSIDTQFVHCD-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 115.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|