C12H9FN6O3 — CID 58681137
(5R)-5-(azidomethyl)-3-[3-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 58681137) has the molecular formula C12H9FN6O3 and a molecular weight of 304.24 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[3-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58681137 |
| Molecular Formula | C12H9FN6O3 |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-(1,2,4-oxadiazol-3-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2ccc(-c3ncon3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C12H9FN6O3/c13-10-3-7(1-2-9(10)11-15-6-21-17-11)19-5-8(4-16-18-14)22-12(19)20/h1-3,6,8H,4-5H2/t8-/m0/s1 |
| InChIKey | NXCSLZWLALAWDV-QMMMGPOBSA-N |
| XLogP | 2.51 |
| TPSA | 117.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|