C15H14FN5O3 — CID 58697735
(5R)-5-(azidomethyl)-3-[3-fluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 58697735) has the molecular formula C15H14FN5O3 and a molecular weight of 331.31 g/mol. Its IUPAC name is (5R)-5-(azidomethyl)-3-[3-fluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58697735 |
| Molecular Formula | C15H14FN5O3 |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | (5R)-5-(azidomethyl)-3-[3-fluoro-4-(4-oxo-2,3-dihydropyridin-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@H]1CN(c2ccc(N3C=CC(=O)CC3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C15H14FN5O3/c16-13-7-10(21-9-12(8-18-19-17)24-15(21)23)1-2-14(13)20-5-3-11(22)4-6-20/h1-3,5,7,12H,4,6,8-9H2/t12-/m0/s1 |
| InChIKey | VDSZVEDAJSCEQI-LBPRGKRZSA-N |
| XLogP | 2.75 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|