C11H12N4O2 — CID 58239154
5-(azidomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one (PubChem CID 58239154) has the molecular formula C11H12N4O2 and a molecular weight of 232.24 g/mol. Its IUPAC name is 5-(azidomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 58239154 |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 5-(azidomethyl)-3-(4-methylphenyl)-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(N2CC(CN=[N+]=[N-])OC2=O)cc1 |
| InChI | InChI=1S/C11H12N4O2/c1-8-2-4-9(5-3-8)15-7-10(6-13-14-12)17-11(15)16/h2-5,10H,6-7H2,1H3 |
| InChIKey | WANFQRMJAOFXNX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|