C11H12N4O4S — CID 10266556
5-(azidomethyl)-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one (PubChem CID 10266556) has the molecular formula C11H12N4O4S and a molecular weight of 296.31 g/mol. Its IUPAC name is 5-(azidomethyl)-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10266556 |
| Molecular Formula | C11H12N4O4S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 5-(azidomethyl)-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(CN=[N+]=[N-])OC2=O)cc1 |
| InChI | InChI=1S/C11H12N4O4S/c1-8-2-4-10(5-3-8)20(17,18)15-7-9(6-13-14-12)19-11(15)16/h2-5,9H,6-7H2,1H3 |
| InChIKey | IZWCUOQUCXRWRS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|