C12H13Cl2NO3S — CID 23628773
3-chloro-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 23628773) has the molecular formula C12H13Cl2NO3S and a molecular weight of 322.21 g/mol. Its IUPAC name is 3-chloro-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | 3-chloro-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 23628773 |
| Molecular Formula | C12H13Cl2NO3S |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | 3-chloro-4-(chloromethyl)-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(CCl)C(Cl)C2=O)cc1 |
| InChI | InChI=1S/C12H13Cl2NO3S/c1-8-2-4-10(5-3-8)19(17,18)15-7-9(6-13)11(14)12(15)16/h2-5,9,11H,6-7H2,1H3 |
| InChIKey | HJDAPJPBYOSUBE-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|