C17H19Cl2NO3S — CID 134946197
(3E,4R)-3-(1,4-dichlorobutylidene)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one (PubChem CID 134946197) has the molecular formula C17H19Cl2NO3S and a molecular weight of 388.32 g/mol. Its IUPAC name is (3E,4R)-3-(1,4-dichlorobutylidene)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one.
| Compound Name | (3E,4R)-3-(1,4-dichlorobutylidene)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134946197 |
| Molecular Formula | C17H19Cl2NO3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (3E,4R)-3-(1,4-dichlorobutylidene)-4-ethenyl-1-(4-methylphenyl)sulfonylpyrrolidin-2-one |
| SMILES | C=C[C@H]1CN(S(=O)(=O)c2ccc(C)cc2)C(=O)/C1=C(/Cl)CCCCl |
| InChI | InChI=1S/C17H19Cl2NO3S/c1-3-13-11-20(17(21)16(13)15(19)5-4-10-18)24(22,23)14-8-6-12(2)7-9-14/h3,6-9,13H,1,4-5,10-11H2,2H3/b16-15+/t13-/m0/s1 |
| InChIKey | ARWUAVDAOPXQBV-ZGTROFRASA-N |
| XLogP | 3.84 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|