C24H24N2O4S2 — CID 10790460
2-ethenyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydroquinoxaline (PubChem CID 10790460) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2-ethenyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydroquinoxaline.
| Compound Name | 2-ethenyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 10790460 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-ethenyl-1,4-bis-(4-methylphenyl)sulfonyl-2,3-dihydroquinoxaline |
| SMILES | C=CC1CN(S(=O)(=O)c2ccc(C)cc2)c2ccccc2N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-4-20-17-25(31(27,28)21-13-9-18(2)10-14-21)23-7-5-6-8-24(23)26(20)32(29,30)22-15-11-19(3)12-16-22/h4-16,20H,1,17H2,2-3H3 |
| InChIKey | LSQUJWVRCXZKKU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|