C24H24N2O5S2 — CID 102589599
(4S,6R)-2,8-bis-(4-methylphenyl)sulfonyl-5-oxa-2,8-diazatricyclo[7.4.0.04,6]trideca-1(13),9,11-triene (PubChem CID 102589599) has the molecular formula C24H24N2O5S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is (4S,6R)-2,8-bis-(4-methylphenyl)sulfonyl-5-oxa-2,8-diazatricyclo[7.4.0.04,6]trideca-1(13),9,11-triene.
| Compound Name | (4S,6R)-2,8-bis-(4-methylphenyl)sulfonyl-5-oxa-2,8-diazatricyclo[7.4.0.04,6]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 102589599 |
| Molecular Formula | C24H24N2O5S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (4S,6R)-2,8-bis-(4-methylphenyl)sulfonyl-5-oxa-2,8-diazatricyclo[7.4.0.04,6]trideca-1(13),9,11-triene |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@@H]3O[C@@H]3CN(S(=O)(=O)c3ccc(C)cc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H24N2O5S2/c1-17-7-11-19(12-8-17)32(27,28)25-15-23-24(31-23)16-26(22-6-4-3-5-21(22)25)33(29,30)20-13-9-18(2)10-14-20/h3-14,23-24H,15-16H2,1-2H3/t23-,24+ |
| InChIKey | ARBDJXYHQLWSBV-PSWAGMNNSA-N |
| XLogP | 3.48 |
| TPSA | 87.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|