C22H20FNO2S — CID 154713489
3-[fluoro(phenyl)methyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 154713489) has the molecular formula C22H20FNO2S and a molecular weight of 381.47 g/mol. Its IUPAC name is 3-[fluoro(phenyl)methyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 3-[fluoro(phenyl)methyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 154713489 |
| Molecular Formula | C22H20FNO2S |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-[fluoro(phenyl)methyl]-1-(4-methylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(C(F)c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H20FNO2S/c1-16-11-13-18(14-12-16)27(25,26)24-15-20(19-9-5-6-10-21(19)24)22(23)17-7-3-2-4-8-17/h2-14,20,22H,15H2,1H3 |
| InChIKey | GKYYJGSFNYZLJN-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |