C25H25NO3S — CID 102587358
6-(4-methylphenyl)sulfonyl-4-phenyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline (PubChem CID 102587358) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 6-(4-methylphenyl)sulfonyl-4-phenyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline.
| Compound Name | 6-(4-methylphenyl)sulfonyl-4-phenyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline |
|---|---|
| PubChem CID | 102587358 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 6-(4-methylphenyl)sulfonyl-4-phenyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C(CCOC3c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-18-11-13-20(14-12-18)30(27,28)26-17-23-21(22-9-5-6-10-24(22)26)15-16-29-25(23)19-7-3-2-4-8-19/h2-14,21,23,25H,15-17H2,1H3 |
| InChIKey | WYTSYISXKZOPRN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |