C17H17NO3S — CID 89273802
(1aR)-4-(4-methylphenyl)sulfonyl-1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzazepine (PubChem CID 89273802) has the molecular formula C17H17NO3S and a molecular weight of 315.39 g/mol. Its IUPAC name is (1aR)-4-(4-methylphenyl)sulfonyl-1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzazepine.
| Compound Name | (1aR)-4-(4-methylphenyl)sulfonyl-1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzazepine |
|---|---|
| PubChem CID | 89273802 |
| Molecular Formula | C17H17NO3S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (1aR)-4-(4-methylphenyl)sulfonyl-1a,2,3,8b-tetrahydrooxireno[2,3-d][1]benzazepine |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H]3OC3c3ccccc32)cc1 |
| InChI | InChI=1S/C17H17NO3S/c1-12-6-8-13(9-7-12)22(19,20)18-11-10-16-17(21-16)14-4-2-3-5-15(14)18/h2-9,16-17H,10-11H2,1H3/t16-,17?/m1/s1 |
| InChIKey | OKPIDVJNSJAQGD-TZHYSIJRSA-N |
| XLogP | 3.03 |
| TPSA | 49.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|