C25H24FNO3S — CID 102587365
4-(3-fluorophenyl)-6-(4-methylphenyl)sulfonyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline (PubChem CID 102587365) has the molecular formula C25H24FNO3S and a molecular weight of 437.54 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-6-(4-methylphenyl)sulfonyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline.
| Compound Name | 4-(3-fluorophenyl)-6-(4-methylphenyl)sulfonyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline |
|---|---|
| PubChem CID | 102587365 |
| Molecular Formula | C25H24FNO3S |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | 4-(3-fluorophenyl)-6-(4-methylphenyl)sulfonyl-1,2,4,4a,5,10b-hexahydropyrano[3,4-c]quinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CC3C(CCOC3c3cccc(F)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C25H24FNO3S/c1-17-9-11-20(12-10-17)31(28,29)27-16-23-21(22-7-2-3-8-24(22)27)13-14-30-25(23)18-5-4-6-19(26)15-18/h2-12,15,21,23,25H,13-14,16H2,1H3 |
| InChIKey | DNVKPZBNQPFKEJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |