C28H25N3O2S — CID 164626964
(6aR,7R,12aS)-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,8]naphthyridine (PubChem CID 164626964) has the molecular formula C28H25N3O2S and a molecular weight of 467.59 g/mol. Its IUPAC name is (6aR,7R,12aS)-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,8]naphthyridine.
| Compound Name | (6aR,7R,12aS)-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,8]naphthyridine |
|---|---|
| PubChem CID | 164626964 |
| Molecular Formula | C28H25N3O2S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.17 |
| IUPAC Name | (6aR,7R,12aS)-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,8]naphthyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3[C@H](c4ccccc4)c4cccnc4N[C@@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C28H25N3O2S/c1-19-13-15-21(16-14-19)34(32,33)31-18-24-26(20-8-3-2-4-9-20)23-11-7-17-29-28(23)30-27(24)22-10-5-6-12-25(22)31/h2-17,24,26-27H,18H2,1H3,(H,29,30)/t24-,26+,27+/m0/s1 |
| InChIKey | WPMBXBQQJIUZEN-WYMJOSIYSA-N |
| XLogP | 5.51 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |