C28H24BrN3O2S — CID 162673281
(6aR,7R,12aS)-9-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,5]naphthyridine (PubChem CID 162673281) has the molecular formula C28H24BrN3O2S and a molecular weight of 546.49 g/mol. Its IUPAC name is (6aR,7R,12aS)-9-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,5]naphthyridine.
| Compound Name | (6aR,7R,12aS)-9-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,5]naphthyridine |
|---|---|
| PubChem CID | 162673281 |
| Molecular Formula | C28H24BrN3O2S |
| Molecular Weight | 546.49 g/mol |
| Exact Mass | 545.08 |
| IUPAC Name | (6aR,7R,12aS)-9-bromo-5-(4-methylphenyl)sulfonyl-7-phenyl-6a,7,12,12a-tetrahydro-6H-quinolino[4,3-b][1,5]naphthyridine |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3[C@H](c4ccccc4)c4nc(Br)ccc4N[C@@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C28H24BrN3O2S/c1-18-11-13-20(14-12-18)35(33,34)32-17-22-26(19-7-3-2-4-8-19)28-23(15-16-25(29)31-28)30-27(22)21-9-5-6-10-24(21)32/h2-16,22,26-27,30H,17H2,1H3/t22-,26-,27+/m0/s1 |
| InChIKey | WOTILRHHXDPEQX-WDDWZANVSA-N |
| XLogP | 6.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.49 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|