C16H15NO4S — CID 95578841
4-[[(3R)-3-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoic acid (PubChem CID 95578841) has the molecular formula C16H15NO4S and a molecular weight of 317.37 g/mol. Its IUPAC name is 4-[[(3R)-3-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoic acid.
| Compound Name | 4-[[(3R)-3-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 95578841 |
| Molecular Formula | C16H15NO4S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | 4-[[(3R)-3-methyl-2,3-dihydroindol-1-yl]sulfonyl]benzoic acid |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(C(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C16H15NO4S/c1-11-10-17(15-5-3-2-4-14(11)15)22(20,21)13-8-6-12(7-9-13)16(18)19/h2-9,11H,10H2,1H3,(H,18,19)/t11-/m0/s1 |
| InChIKey | PRRNETJIFWCAPK-NSHDSACASA-N |
| XLogP | 2.70 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |