C16H14N2O5S — CID 110713476
4-[(4-methyl-3-oxo-2H-quinoxalin-1-yl)sulfonyl]benzoic acid (PubChem CID 110713476) has the molecular formula C16H14N2O5S and a molecular weight of 346.36 g/mol. Its IUPAC name is 4-[(4-methyl-3-oxo-2H-quinoxalin-1-yl)sulfonyl]benzoic acid.
| Compound Name | 4-[(4-methyl-3-oxo-2H-quinoxalin-1-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 110713476 |
| Molecular Formula | C16H14N2O5S |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 4-[(4-methyl-3-oxo-2H-quinoxalin-1-yl)sulfonyl]benzoic acid |
| SMILES | CN1C(=O)CN(S(=O)(=O)c2ccc(C(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C16H14N2O5S/c1-17-13-4-2-3-5-14(13)18(10-15(17)19)24(22,23)12-8-6-11(7-9-12)16(20)21/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | BYAQVLZXRRQLEI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |