C20H16N2O5S2 — CID 142915511
4-[(2-carbamoyl-4,5-dihydrothiopyrano[3,2-c]quinolin-6-yl)sulfonyl]benzoic acid (PubChem CID 142915511) has the molecular formula C20H16N2O5S2 and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-[(2-carbamoyl-4,5-dihydrothiopyrano[3,2-c]quinolin-6-yl)sulfonyl]benzoic acid.
| Compound Name | 4-[(2-carbamoyl-4,5-dihydrothiopyrano[3,2-c]quinolin-6-yl)sulfonyl]benzoic acid |
|---|---|
| PubChem CID | 142915511 |
| Molecular Formula | C20H16N2O5S2 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.05 |
| IUPAC Name | 4-[(2-carbamoyl-4,5-dihydrothiopyrano[3,2-c]quinolin-6-yl)sulfonyl]benzoic acid |
| SMILES | NC(=O)C1=CCC2=C(S1)c1ccccc1N(S(=O)(=O)c1ccc(C(=O)O)cc1)C2 |
| InChI | InChI=1S/C20H16N2O5S2/c21-19(23)17-10-7-13-11-22(16-4-2-1-3-15(16)18(13)28-17)29(26,27)14-8-5-12(6-9-14)20(24)25/h1-6,8-10H,7,11H2,(H2,21,23)(H,24,25) |
| InChIKey | CWLXSDMUNUALJR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |