C11H13NO6S — CID 106668323
4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoic acid (PubChem CID 106668323) has the molecular formula C11H13NO6S and a molecular weight of 287.29 g/mol. Its IUPAC name is 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoic acid.
| Compound Name | 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoic acid |
|---|---|
| PubChem CID | 106668323 |
| Molecular Formula | C11H13NO6S |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 4-(3,4-dihydroxypyrrolidin-1-yl)sulfonylbenzoic acid |
| SMILES | O=C(O)c1ccc(S(=O)(=O)N2CC(O)C(O)C2)cc1 |
| InChI | InChI=1S/C11H13NO6S/c13-9-5-12(6-10(9)14)19(17,18)8-3-1-7(2-4-8)11(15)16/h1-4,9-10,13-14H,5-6H2,(H,15,16) |
| InChIKey | OAKFIGIPMQLICG-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |