C11H12FNO6S — CID 106668302
3-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-4-fluorobenzoic acid (PubChem CID 106668302) has the molecular formula C11H12FNO6S and a molecular weight of 305.28 g/mol. Its IUPAC name is 3-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-4-fluorobenzoic acid.
| Compound Name | 3-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 106668302 |
| Molecular Formula | C11H12FNO6S |
| Molecular Weight | 305.28 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | 3-(3,4-dihydroxypyrrolidin-1-yl)sulfonyl-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)N2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C11H12FNO6S/c12-7-2-1-6(11(16)17)3-10(7)20(18,19)13-4-8(14)9(15)5-13/h1-3,8-9,14-15H,4-5H2,(H,16,17) |
| InChIKey | GFBZGYAWUUOQNF-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |