C10H12FNO3S — CID 63105517
1-(2-fluoro-5-methylphenyl)sulfonylazetidin-3-ol (PubChem CID 63105517) has the molecular formula C10H12FNO3S and a molecular weight of 245.27 g/mol. Its IUPAC name is 1-(2-fluoro-5-methylphenyl)sulfonylazetidin-3-ol.
| Compound Name | 1-(2-fluoro-5-methylphenyl)sulfonylazetidin-3-ol |
|---|---|
| PubChem CID | 63105517 |
| Molecular Formula | C10H12FNO3S |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 1-(2-fluoro-5-methylphenyl)sulfonylazetidin-3-ol |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2CC(O)C2)c1 |
| InChI | InChI=1S/C10H12FNO3S/c1-7-2-3-9(11)10(4-7)16(14,15)12-5-8(13)6-12/h2-4,8,13H,5-6H2,1H3 |
| InChIKey | AVXYYDRRLGDPRE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |