C12H17NO4S — CID 71683265
(3S,4R)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 71683265) has the molecular formula C12H17NO4S and a molecular weight of 271.34 g/mol. Its IUPAC name is (3S,4R)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 71683265 |
| Molecular Formula | C12H17NO4S |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | (3S,4R)-1-(2,5-dimethylphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2C[C@@H](O)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C12H17NO4S/c1-8-3-4-9(2)12(5-8)18(16,17)13-6-10(14)11(15)7-13/h3-5,10-11,14-15H,6-7H2,1-2H3/t10-,11+ |
| InChIKey | YCUGQHUJVZTRLN-PHIMTYICSA-N |
| XLogP | 0.03 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |