C13H19NO4S — CID 131932032
(3S,4S)-1-(2,4-dimethylphenyl)sulfonylpiperidine-3,4-diol (PubChem CID 131932032) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is (3S,4S)-1-(2,4-dimethylphenyl)sulfonylpiperidine-3,4-diol.
| Compound Name | (3S,4S)-1-(2,4-dimethylphenyl)sulfonylpiperidine-3,4-diol |
|---|---|
| PubChem CID | 131932032 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (3S,4S)-1-(2,4-dimethylphenyl)sulfonylpiperidine-3,4-diol |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[C@H](O)[C@@H](O)C2)c(C)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-9-3-4-13(10(2)7-9)19(17,18)14-6-5-11(15)12(16)8-14/h3-4,7,11-12,15-16H,5-6,8H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | OEJQYSJNDSDCPZ-RYUDHWBXSA-N |
| XLogP | 0.42 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |