C11H14FNO4S — CID 79410588
(3S,4R)-1-(5-fluoro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol (PubChem CID 79410588) has the molecular formula C11H14FNO4S and a molecular weight of 275.30 g/mol. Its IUPAC name is (3S,4R)-1-(5-fluoro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(5-fluoro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 79410588 |
| Molecular Formula | C11H14FNO4S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | (3S,4R)-1-(5-fluoro-2-methylphenyl)sulfonylpyrrolidine-3,4-diol |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1C[C@@H](O)[C@@H](O)C1 |
| InChI | InChI=1S/C11H14FNO4S/c1-7-2-3-8(12)4-11(7)18(16,17)13-5-9(14)10(15)6-13/h2-4,9-10,14-15H,5-6H2,1H3/t9-,10+ |
| InChIKey | USOSIJQJWLJHEE-AOOOYVTPSA-N |
| XLogP | -0.14 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |