C13H18FNO2S — CID 145499915
1-(5-fluoro-2-methylphenyl)sulfonyl-4-methylpiperidine (PubChem CID 145499915) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)sulfonyl-4-methylpiperidine.
| Compound Name | 1-(5-fluoro-2-methylphenyl)sulfonyl-4-methylpiperidine |
|---|---|
| PubChem CID | 145499915 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)sulfonyl-4-methylpiperidine |
| SMILES | Cc1ccc(F)cc1S(=O)(=O)N1CCC(C)CC1 |
| InChI | InChI=1S/C13H18FNO2S/c1-10-5-7-15(8-6-10)18(16,17)13-9-12(14)4-3-11(13)2/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | DWCWTICUZFYDEF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |