C15H21FN2O3S — CID 129482096
(4aS,8aS)-6-(2-fluoro-5-methylphenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 129482096) has the molecular formula C15H21FN2O3S and a molecular weight of 328.41 g/mol. Its IUPAC name is (4aS,8aS)-6-(2-fluoro-5-methylphenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | (4aS,8aS)-6-(2-fluoro-5-methylphenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 129482096 |
| Molecular Formula | C15H21FN2O3S |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (4aS,8aS)-6-(2-fluoro-5-methylphenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N2CC[C@@H]3OCCN(C)[C@H]3C2)c1 |
| InChI | InChI=1S/C15H21FN2O3S/c1-11-3-4-12(16)15(9-11)22(19,20)18-6-5-14-13(10-18)17(2)7-8-21-14/h3-4,9,13-14H,5-8,10H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | CKVRGJRTYQVCCN-KBPBESRZSA-N |
| XLogP | 1.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |