C14H18F2N2O3S — CID 128964327
6-(2,5-difluorophenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 128964327) has the molecular formula C14H18F2N2O3S and a molecular weight of 332.37 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 6-(2,5-difluorophenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 128964327 |
| Molecular Formula | C14H18F2N2O3S |
| Molecular Weight | 332.37 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 6-(2,5-difluorophenyl)sulfonyl-4-methyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | CN1CCOC2CCN(S(=O)(=O)c3cc(F)ccc3F)CC21 |
| InChI | InChI=1S/C14H18F2N2O3S/c1-17-6-7-21-13-4-5-18(9-12(13)17)22(19,20)14-8-10(15)2-3-11(14)16/h2-3,8,12-13H,4-7,9H2,1H3 |
| InChIKey | PSNYPKIUBHWDDF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |