C19H20FNO5S — CID 166621347
4-fluoro-3-[3-[(4-methoxyphenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid (PubChem CID 166621347) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is 4-fluoro-3-[3-[(4-methoxyphenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid.
| Compound Name | 4-fluoro-3-[3-[(4-methoxyphenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid |
|---|---|
| PubChem CID | 166621347 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 4-fluoro-3-[3-[(4-methoxyphenyl)methyl]pyrrolidin-1-yl]sulfonylbenzoic acid |
| SMILES | COc1ccc(CC2CCN(S(=O)(=O)c3cc(C(=O)O)ccc3F)C2)cc1 |
| InChI | InChI=1S/C19H20FNO5S/c1-26-16-5-2-13(3-6-16)10-14-8-9-21(12-14)27(24,25)18-11-15(19(22)23)4-7-17(18)20/h2-7,11,14H,8-10,12H2,1H3,(H,22,23) |
| InChIKey | RKRZVDJGHDYYNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |