C19H22FNO3S — CID 46086751
1-(3-fluorophenyl)sulfonyl-4-[(4-methoxyphenyl)methyl]piperidine (PubChem CID 46086751) has the molecular formula C19H22FNO3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-4-[(4-methoxyphenyl)methyl]piperidine.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-4-[(4-methoxyphenyl)methyl]piperidine |
|---|---|
| PubChem CID | 46086751 |
| Molecular Formula | C19H22FNO3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-4-[(4-methoxyphenyl)methyl]piperidine |
| SMILES | COc1ccc(CC2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22FNO3S/c1-24-18-7-5-15(6-8-18)13-16-9-11-21(12-10-16)25(22,23)19-4-2-3-17(20)14-19/h2-8,14,16H,9-13H2,1H3 |
| InChIKey | KOMZWCGDANZKAV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |