C26H27FN2O3S — CID 66821278
(3aR,10bS)-5-(3-fluorophenyl)sulfonyl-2-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine (PubChem CID 66821278) has the molecular formula C26H27FN2O3S and a molecular weight of 466.58 g/mol. Its IUPAC name is (3aR,10bS)-5-(3-fluorophenyl)sulfonyl-2-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine.
| Compound Name | (3aR,10bS)-5-(3-fluorophenyl)sulfonyl-2-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
|---|---|
| PubChem CID | 66821278 |
| Molecular Formula | C26H27FN2O3S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (3aR,10bS)-5-(3-fluorophenyl)sulfonyl-2-[(4-methoxyphenyl)methyl]-1,3,3a,4,6,10b-hexahydropyrrolo[3,4-d][2]benzazepine |
| SMILES | COc1ccc(CN2C[C@@H]3CN(S(=O)(=O)c4cccc(F)c4)Cc4ccccc4[C@H]3C2)cc1 |
| InChI | InChI=1S/C26H27FN2O3S/c1-32-23-11-9-19(10-12-23)14-28-15-21-17-29(33(30,31)24-7-4-6-22(27)13-24)16-20-5-2-3-8-25(20)26(21)18-28/h2-13,21,26H,14-18H2,1H3/t21-,26+/m1/s1 |
| InChIKey | BYPGXQIEDARTLA-RLWLMLJZSA-N |
| XLogP | 4.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |