C19H24FN2O4S+ — CID 8966240
1-(3-fluorophenyl)sulfonyl-4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium (PubChem CID 8966240) has the molecular formula C19H24FN2O4S+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-(3-fluorophenyl)sulfonyl-4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium.
| Compound Name | 1-(3-fluorophenyl)sulfonyl-4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium |
|---|---|
| PubChem CID | 8966240 |
| Molecular Formula | C19H24FN2O4S+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(3-fluorophenyl)sulfonyl-4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium |
| SMILES | COc1ccc(OCC[NH+]2CCN(S(=O)(=O)c3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-25-17-5-7-18(8-6-17)26-14-13-21-9-11-22(12-10-21)27(23,24)19-4-2-3-16(20)15-19/h2-8,15H,9-14H2,1H3/p+1 |
| InChIKey | IIUCPSYAAIKLDS-UHFFFAOYSA-O |
| XLogP | 0.80 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |