C21H27N2O5S+ — CID 9301071
1-[3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone (PubChem CID 9301071) has the molecular formula C21H27N2O5S+ and a molecular weight of 419.52 g/mol. Its IUPAC name is 1-[3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 9301071 |
| Molecular Formula | C21H27N2O5S+ |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | 1-[3-[4-[2-(4-methoxyphenoxy)ethyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone |
| SMILES | COc1ccc(OCC[NH+]2CCN(S(=O)(=O)c3cccc(C(C)=O)c3)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-17(24)18-4-3-5-21(16-18)29(25,26)23-12-10-22(11-13-23)14-15-28-20-8-6-19(27-2)7-9-20/h3-9,16H,10-15H2,1-2H3/p+1 |
| InChIKey | FYFFUBCFGCRGCK-UHFFFAOYSA-O |
| XLogP | 0.87 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |