C20H25N2O4S+ — CID 9337838
1-[4-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone (PubChem CID 9337838) has the molecular formula C20H25N2O4S+ and a molecular weight of 389.50 g/mol. Its IUPAC name is 1-[4-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 9337838 |
| Molecular Formula | C20H25N2O4S+ |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | 1-[4-[4-[(3-methoxyphenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]ethanone |
| SMILES | COc1cccc(C[NH+]2CCN(S(=O)(=O)c3ccc(C(C)=O)cc3)CC2)c1 |
| InChI | InChI=1S/C20H24N2O4S/c1-16(23)18-6-8-20(9-7-18)27(24,25)22-12-10-21(11-13-22)15-17-4-3-5-19(14-17)26-2/h3-9,14H,10-13,15H2,1-2H3/p+1 |
| InChIKey | VTAMVSILRJHSML-UHFFFAOYSA-O |
| XLogP | 0.99 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |