C19H23ClN3O3S+ — CID 7028954
N-[4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide (PubChem CID 7028954) has the molecular formula C19H23ClN3O3S+ and a molecular weight of 408.93 g/mol. Its IUPAC name is N-[4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide.
| Compound Name | N-[4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide |
|---|---|
| PubChem CID | 7028954 |
| Molecular Formula | C19H23ClN3O3S+ |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | N-[4-[4-[(3-chlorophenyl)methyl]piperazin-4-ium-1-yl]sulfonylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N2CC[NH+](Cc3cccc(Cl)c3)CC2)cc1 |
| InChI | InChI=1S/C19H22ClN3O3S/c1-15(24)21-18-5-7-19(8-6-18)27(25,26)23-11-9-22(10-12-23)14-16-3-2-4-17(20)13-16/h2-8,13H,9-12,14H2,1H3,(H,21,24)/p+1 |
| InChIKey | ODUBGPPYMWHSTM-UHFFFAOYSA-O |
| XLogP | 1.39 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |