C20H25N4O4S+ — CID 8743627
N-(4-acetamidophenyl)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8743627) has the molecular formula C20H25N4O4S+ and a molecular weight of 417.51 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(4-acetamidophenyl)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8743627 |
| Molecular Formula | C20H25N4O4S+ |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.16 |
| IUPAC Name | N-(4-acetamidophenyl)-2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O4S/c1-16(25)21-17-7-9-18(10-8-17)22-20(26)15-23-11-13-24(14-12-23)29(27,28)19-5-3-2-4-6-19/h2-10H,11-15H2,1H3,(H,21,25)(H,22,26)/p+1 |
| InChIKey | OQXPZMVMHZUXCQ-UHFFFAOYSA-O |
| XLogP | 0.17 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |