C20H26N3O3S+ — CID 2655575
2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 2655575) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 2655575 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | Cc1cc(C)cc(NC(=O)C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25N3O3S/c1-16-12-17(2)14-18(13-16)21-20(24)15-22-8-10-23(11-9-22)27(25,26)19-6-4-3-5-7-19/h3-7,12-14H,8-11,15H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | TTYGIVCMADDHTP-UHFFFAOYSA-O |
| XLogP | 0.83 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |