C20H26N3O5S+ — CID 3480604
N-(3-methoxyphenyl)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 3480604) has the molecular formula C20H26N3O5S+ and a molecular weight of 420.51 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-methoxyphenyl)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 3480604 |
| Molecular Formula | C20H26N3O5S+ |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | N-(3-methoxyphenyl)-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)Nc3cccc(OC)c3)CC2)cc1 |
| InChI | InChI=1S/C20H25N3O5S/c1-27-17-6-8-19(9-7-17)29(25,26)23-12-10-22(11-13-23)15-20(24)21-16-4-3-5-18(14-16)28-2/h3-9,14H,10-13,15H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | QORAQONQHDGBLT-UHFFFAOYSA-O |
| XLogP | 0.23 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |