C18H28N3O6S+ — CID 8687510
methyl 4-[[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]butanoate (PubChem CID 8687510) has the molecular formula C18H28N3O6S+ and a molecular weight of 414.50 g/mol. Its IUPAC name is methyl 4-[[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]butanoate.
| Compound Name | methyl 4-[[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]butanoate |
|---|---|
| PubChem CID | 8687510 |
| Molecular Formula | C18H28N3O6S+ |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | methyl 4-[[2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetyl]amino]butanoate |
| SMILES | COC(=O)CCCNC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C18H27N3O6S/c1-26-15-5-7-16(8-6-15)28(24,25)21-12-10-20(11-13-21)14-17(22)19-9-3-4-18(23)27-2/h5-8H,3-4,9-14H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | JGAYSRREAHSGLL-UHFFFAOYSA-O |
| XLogP | -1.35 |
| TPSA | 106.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|