C23H32N3O3S+ — CID 8758149
2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(3-phenylpropyl)acetamide (PubChem CID 8758149) has the molecular formula C23H32N3O3S+ and a molecular weight of 430.59 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 8758149 |
| Molecular Formula | C23H32N3O3S+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]-N-(3-phenylpropyl)acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)NCCCc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C23H31N3O3S/c1-19-10-11-22(17-20(19)2)30(28,29)26-15-13-25(14-16-26)18-23(27)24-12-6-9-21-7-4-3-5-8-21/h3-5,7-8,10-11,17H,6,9,12-16,18H2,1-2H3,(H,24,27)/p+1 |
| InChIKey | RBYIJRMKFPKGHZ-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|