C24H30N2O6S — CID 55307949
[2-oxo-2-(3-phenylpropylamino)ethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 55307949) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylpropylamino)ethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55307949 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [2-oxo-2-(3-phenylpropylamino)ethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)N2CC(O)CC2C(=O)OCC(=O)NCCCc2ccccc2)cc1C |
| InChI | InChI=1S/C24H30N2O6S/c1-17-10-11-21(13-18(17)2)33(30,31)26-15-20(27)14-22(26)24(29)32-16-23(28)25-12-6-9-19-7-4-3-5-8-19/h3-5,7-8,10-11,13,20,22,27H,6,9,12,14-16H2,1-2H3,(H,25,28) |
| InChIKey | JLPAEGORYSCTIP-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|