C19H28N2O6S — CID 55307677
[2-(butylamino)-2-oxoethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate (PubChem CID 55307677) has the molecular formula C19H28N2O6S and a molecular weight of 412.51 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 55307677 |
| Molecular Formula | C19H28N2O6S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 1-(3,4-dimethylphenyl)sulfonyl-4-hydroxypyrrolidine-2-carboxylate |
| SMILES | CCCCNC(=O)COC(=O)C1CC(O)CN1S(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C19H28N2O6S/c1-4-5-8-20-18(23)12-27-19(24)17-10-15(22)11-21(17)28(25,26)16-7-6-13(2)14(3)9-16/h6-7,9,15,17,22H,4-5,8,10-12H2,1-3H3,(H,20,23) |
| InChIKey | GSOJVMIIJKSVCE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|