C21H34N3O3S+ — CID 8789812
N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 8789812) has the molecular formula C21H34N3O3S+ and a molecular weight of 408.59 g/mol. Its IUPAC name is N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8789812 |
| Molecular Formula | C21H34N3O3S+ |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-pentyl-2-[4-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCCNC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc3c(c2)CCCC3)CC1 |
| InChI | InChI=1S/C21H33N3O3S/c1-2-3-6-11-22-21(25)17-23-12-14-24(15-13-23)28(26,27)20-10-9-18-7-4-5-8-19(18)16-20/h9-10,16H,2-8,11-15,17H2,1H3,(H,22,25)/p+1 |
| InChIKey | NNXRARLEICLZHR-UHFFFAOYSA-O |
| XLogP | 0.76 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|