C19H31N4O4S+ — CID 8691477
N-(butylcarbamoyl)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8691477) has the molecular formula C19H31N4O4S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(butylcarbamoyl)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8691477 |
| Molecular Formula | C19H31N4O4S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-(butylcarbamoyl)-2-[4-(3,4-dimethylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(C)c(C)c2)CC1 |
| InChI | InChI=1S/C19H30N4O4S/c1-4-5-8-20-19(25)21-18(24)14-22-9-11-23(12-10-22)28(26,27)17-7-6-15(2)16(3)13-17/h6-7,13H,4-5,8-12,14H2,1-3H3,(H2,20,21,24,25)/p+1 |
| InChIKey | QHSLUSWKSVTBRS-UHFFFAOYSA-O |
| XLogP | -0.18 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|