C19H31N4O4S+ — CID 8742721
N-(3-methylbutylcarbamoyl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8742721) has the molecular formula C19H31N4O4S+ and a molecular weight of 411.55 g/mol. Its IUPAC name is N-(3-methylbutylcarbamoyl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(3-methylbutylcarbamoyl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8742721 |
| Molecular Formula | C19H31N4O4S+ |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.21 |
| IUPAC Name | N-(3-methylbutylcarbamoyl)-2-[4-(4-methylphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CC[NH+](CC(=O)NC(=O)NCCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O4S/c1-15(2)8-9-20-19(25)21-18(24)14-22-10-12-23(13-11-22)28(26,27)17-6-4-16(3)5-7-17/h4-7,15H,8-14H2,1-3H3,(H2,20,21,24,25)/p+1 |
| InChIKey | GSBCMMSHAVWKFB-UHFFFAOYSA-O |
| XLogP | -0.24 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |